About N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine
N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine (PubChem CID 126654289) has the molecular formula C14H31NOS
and a molecular weight of 261.47 g/mol. Its IUPAC name is N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine |
| PubChem CID | 126654289 |
| Molecular Formula | C14H31NOS |
| Molecular Weight | 261.47 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)COCCCSCCNC(C)(C)C |
| InChI | InChI=1S/C14H31NOS/c1-13(2,3)12-16-9-7-10-17-11-8-15-14(4,5)6/h15H,7-12H2,1-6H3 |
| InChIKey | NZQOMKUFOBAGCN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine (CID 126654289) is N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine is CC(C)(C)COCCCSCCNC(C)(C)C.
What is the InChIKey of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine?
The InChIKey is NZQOMKUFOBAGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NOS/c1-13(2,3)12-16-9-7-10-17-11-8-15-14(4,5)6/h15H,7-12H2,1-6H3.
What are the key properties of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine?
N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine has a molecular weight of 261.47 g/mol, XLogP of 3.56, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2-methylpropan-2-amine is sourced from PubChem (CID 126654289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).