C17H37N3 — CID 126654304
N-[3-[4-(3,3-dimethylbutyl)piperazin-1-yl]propyl]-2-methylpropan-2-amine (PubChem CID 126654304) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is N-[3-[4-(3,3-dimethylbutyl)piperazin-1-yl]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-[4-(3,3-dimethylbutyl)piperazin-1-yl]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 126654304 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | N-[3-[4-(3,3-dimethylbutyl)piperazin-1-yl]propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)CCN1CCN(CCCNC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H37N3/c1-16(2,3)8-11-20-14-12-19(13-15-20)10-7-9-18-17(4,5)6/h18H,7-15H2,1-6H3 |
| InChIKey | UJBFHXGSUWGJSY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|