C18H21NO5S — CID 1266545
(3R)-3-(benzylsulfonylamino)-3-(4-ethoxyphenyl)propanoic acid (PubChem CID 1266545) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is (3R)-3-(benzylsulfonylamino)-3-(4-ethoxyphenyl)propanoic acid.
| Compound Name | (3R)-3-(benzylsulfonylamino)-3-(4-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 1266545 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3R)-3-(benzylsulfonylamino)-3-(4-ethoxyphenyl)propanoic acid |
| SMILES | CCOc1ccc([C@@H](CC(=O)O)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-2-24-16-10-8-15(9-11-16)17(12-18(20)21)19-25(22,23)13-14-6-4-3-5-7-14/h3-11,17,19H,2,12-13H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | IIEIWLRWUKJECW-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |