About 6-bromo-3-methyl-3,4-dihydropyridine
6-bromo-3-methyl-3,4-dihydropyridine (PubChem CID 126655121) has the molecular formula C6H8BrN
and a molecular weight of 174.04 g/mol. Its IUPAC name is 6-bromo-3-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-bromo-3-methyl-3,4-dihydropyridine |
| PubChem CID | 126655121 |
| Molecular Formula | C6H8BrN |
| Molecular Weight | 174.04 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 6-bromo-3-methyl-3,4-dihydropyridine |
| SMILES | CC1C=NC(Br)=CC1 |
| InChI | InChI=1S/C6H8BrN/c1-5-2-3-6(7)8-4-5/h3-5H,2H2,1H3 |
| InChIKey | VVMSWSQSPVRRHN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.04 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-methyl-3,4-dihydropyridine?
The IUPAC name of 6-bromo-3-methyl-3,4-dihydropyridine (CID 126655121) is 6-bromo-3-methyl-3,4-dihydropyridine.
What is the SMILES notation for 6-bromo-3-methyl-3,4-dihydropyridine?
The canonical SMILES for 6-bromo-3-methyl-3,4-dihydropyridine is CC1C=NC(Br)=CC1.
What is the InChIKey of 6-bromo-3-methyl-3,4-dihydropyridine?
The InChIKey is VVMSWSQSPVRRHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN/c1-5-2-3-6(7)8-4-5/h3-5H,2H2,1H3.
What are the key properties of 6-bromo-3-methyl-3,4-dihydropyridine?
6-bromo-3-methyl-3,4-dihydropyridine has a molecular weight of 174.04 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-methyl-3,4-dihydropyridine is sourced from PubChem (CID 126655121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).