C10H16N4O — CID 126655644
(4aS)-4-methyl-6-(1H-pyrazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 126655644) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is (4aS)-4-methyl-6-(1H-pyrazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS)-4-methyl-6-(1H-pyrazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 126655644 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (4aS)-4-methyl-6-(1H-pyrazol-5-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCOC2CN(c3ccn[nH]3)C[C@@H]21 |
| InChI | InChI=1S/C10H16N4O/c1-13-4-5-15-9-7-14(6-8(9)13)10-2-3-11-12-10/h2-3,8-9H,4-7H2,1H3,(H,11,12)/t8-,9?/m0/s1 |
| InChIKey | NAFGHXJENJBWPQ-IENPIDJESA-N |
| XLogP | -0.07 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |