About 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one
4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one (PubChem CID 126655656) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one |
| PubChem CID | 126655656 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one |
| SMILES | CC1=C(c2ccn[nH]2)CNC1=O |
| InChI | InChI=1S/C8H9N3O/c1-5-6(4-9-8(5)12)7-2-3-10-11-7/h2-3H,4H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | IZPFWFNUIWCBEF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one (CID 126655656) is 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one is CC1=C(c2ccn[nH]2)CNC1=O.
What is the InChIKey of 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one?
The InChIKey is IZPFWFNUIWCBEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-6(4-9-8(5)12)7-2-3-10-11-7/h2-3H,4H2,1H3,(H,9,12)(H,10,11).
What are the key properties of 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one?
4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one has a molecular weight of 163.18 g/mol, XLogP of 0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(1H-pyrazol-5-yl)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 126655656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).