C24H29F3N4O3S — CID 126655729
5-[(3E,7E)-9-imino-4,8-dimethyl-6-methylidene-9-[1-(trifluoromethylsulfonyl)piperidin-4-yl]nona-1,3,7-trien-5-yl]pyridine-2-carboxamide (PubChem CID 126655729) has the molecular formula C24H29F3N4O3S and a molecular weight of 510.58 g/mol. Its IUPAC name is 5-[(3E,7E)-9-imino-4,8-dimethyl-6-methylidene-9-[1-(trifluoromethylsulfonyl)piperidin-4-yl]nona-1,3,7-trien-5-yl]pyridine-2-carboxamide.
| Compound Name | 5-[(3E,7E)-9-imino-4,8-dimethyl-6-methylidene-9-[1-(trifluoromethylsulfonyl)piperidin-4-yl]nona-1,3,7-trien-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126655729 |
| Molecular Formula | C24H29F3N4O3S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 5-[(3E,7E)-9-imino-4,8-dimethyl-6-methylidene-9-[1-(trifluoromethylsulfonyl)piperidin-4-yl]nona-1,3,7-trien-5-yl]pyridine-2-carboxamide |
| SMILES | [H]/N=C(C(\C)=C\C(=C)C(/C(C)=C/C=C)c1ccc(C(N)=O)nc1)/C1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H29F3N4O3S/c1-5-6-15(2)21(19-7-8-20(23(29)32)30-14-19)16(3)13-17(4)22(28)18-9-11-31(12-10-18)35(33,34)24(25,26)27/h5-8,13-14,18,21,28H,1,3,9-12H2,2,4H3,(H2,29,32)/b15-6+,17-13+,28-22+ |
| InChIKey | WGESEBRIAMZNEW-LLGJDYTASA-N |
| XLogP | 4.48 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|