C26H23ClN4O — CID 126656057
2-[3-[2-chloro-7-(propoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroindene-2-carbonitrile (PubChem CID 126656057) has the molecular formula C26H23ClN4O and a molecular weight of 442.95 g/mol. Its IUPAC name is 2-[3-[2-chloro-7-(propoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroindene-2-carbonitrile.
| Compound Name | 2-[3-[2-chloro-7-(propoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroindene-2-carbonitrile |
|---|---|
| PubChem CID | 126656057 |
| Molecular Formula | C26H23ClN4O |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[3-[2-chloro-7-(propoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroindene-2-carbonitrile |
| SMILES | CCCOCn1ccc2c(-c3cccc(C4(C#N)Cc5ccccc5C4)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C26H23ClN4O/c1-2-12-32-17-31-11-10-22-23(29-25(27)30-24(22)31)18-8-5-9-21(13-18)26(16-28)14-19-6-3-4-7-20(19)15-26/h3-11,13H,2,12,14-15,17H2,1H3 |
| InChIKey | UNKCMKHXCQHRGY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|