About 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine
2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine (PubChem CID 126656297) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine |
| PubChem CID | 126656297 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine |
| SMILES | C/C=C(\C=C(C)C)C1(N)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H21N/c1-4-15(9-12(2)3)16(17)10-13-7-5-6-8-14(13)11-16/h4-9H,10-11,17H2,1-3H3/b15-4+ |
| InChIKey | MQEJMGBHJKWPEN-SYZQJQIISA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine?
The IUPAC name of 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine (CID 126656297) is 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine.
What is the SMILES notation for 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine?
The canonical SMILES for 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine is C/C=C(\C=C(C)C)C1(N)Cc2ccccc2C1.
What is the InChIKey of 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine?
The InChIKey is MQEJMGBHJKWPEN-SYZQJQIISA-N. The full InChI is InChI=1S/C16H21N/c1-4-15(9-12(2)3)16(17)10-13-7-5-6-8-14(13)11-16/h4-9H,10-11,17H2,1-3H3/b15-4+.
What are the key properties of 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine?
2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine has a molecular weight of 227.35 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-5-methylhexa-2,4-dien-3-yl]-1,3-dihydroinden-2-amine is sourced from PubChem (CID 126656297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).