About 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol
4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol (PubChem CID 126656779) has the molecular formula C10H20O3S
and a molecular weight of 220.33 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol |
| PubChem CID | 126656779 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)CC1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20O3S/c1-9(2,3)8-10(11)4-6-14(12,13)7-5-10/h11H,4-8H2,1-3H3 |
| InChIKey | CFADSRVZTXDRTP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol?
The IUPAC name of 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol (CID 126656779) is 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol.
What is the SMILES notation for 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol?
The canonical SMILES for 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol is CC(C)(C)CC1(O)CCS(=O)(=O)CC1.
What is the InChIKey of 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol?
The InChIKey is CFADSRVZTXDRTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3S/c1-9(2,3)8-10(11)4-6-14(12,13)7-5-10/h11H,4-8H2,1-3H3.
What are the key properties of 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol?
4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol has a molecular weight of 220.33 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropyl)-1,1-dioxothian-4-ol is sourced from PubChem (CID 126656779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).