C24H31N3O3 — CID 126656830
[(2R,6S,7S)-7-ethyl-6-methyl-19-(methylcarbamoyl)-9,19-diazapentacyclo[10.7.0.02,8.04,9.013,18]nonadeca-1(12),13(18),14,16-tetraen-15-yl] acetate (PubChem CID 126656830) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is [(2R,6S,7S)-7-ethyl-6-methyl-19-(methylcarbamoyl)-9,19-diazapentacyclo[10.7.0.02,8.04,9.013,18]nonadeca-1(12),13(18),14,16-tetraen-15-yl] acetate.
| Compound Name | [(2R,6S,7S)-7-ethyl-6-methyl-19-(methylcarbamoyl)-9,19-diazapentacyclo[10.7.0.02,8.04,9.013,18]nonadeca-1(12),13(18),14,16-tetraen-15-yl] acetate |
|---|---|
| PubChem CID | 126656830 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | [(2R,6S,7S)-7-ethyl-6-methyl-19-(methylcarbamoyl)-9,19-diazapentacyclo[10.7.0.02,8.04,9.013,18]nonadeca-1(12),13(18),14,16-tetraen-15-yl] acetate |
| SMILES | CC[C@@H]1C2[C@H]3CC(C[C@@H]1C)N2CCc1c3n(C(=O)NC)c2ccc(OC(C)=O)cc12 |
| InChI | InChI=1S/C24H31N3O3/c1-5-17-13(2)10-15-11-20-22(17)26(15)9-8-18-19-12-16(30-14(3)28)6-7-21(19)27(23(18)20)24(29)25-4/h6-7,12-13,15,17,20,22H,5,8-11H2,1-4H3,(H,25,29)/t13-,15?,17-,20+,22?/m0/s1 |
| InChIKey | WERCIVBQODRXNR-JLVYHHIESA-N |
| XLogP | 3.90 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|