About (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate
(2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate (PubChem CID 126656983) has the molecular formula C9H7Cl2NO2S
and a molecular weight of 264.13 g/mol. Its IUPAC name is (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate.
Molecular Properties
| Compound Name | (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate |
| PubChem CID | 126656983 |
| Molecular Formula | C9H7Cl2NO2S |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate |
| SMILES | COc1cc(OC)c(Cl)c(SC#N)c1Cl |
| InChI | InChI=1S/C9H7Cl2NO2S/c1-13-5-3-6(14-2)8(11)9(7(5)10)15-4-12/h3H,1-2H3 |
| InChIKey | NOLRKCYSFIMFGC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate?
The IUPAC name of (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate (CID 126656983) is (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate.
What is the SMILES notation for (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate?
The canonical SMILES for (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate is COc1cc(OC)c(Cl)c(SC#N)c1Cl.
What is the InChIKey of (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate?
The InChIKey is NOLRKCYSFIMFGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO2S/c1-13-5-3-6(14-2)8(11)9(7(5)10)15-4-12/h3H,1-2H3.
What are the key properties of (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate?
(2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate has a molecular weight of 264.13 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichloro-3,5-dimethoxyphenyl) thiocyanate is sourced from PubChem (CID 126656983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).