C21H38N4O2 — CID 126657870
3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-methylurea (PubChem CID 126657870) has the molecular formula C21H38N4O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-methylurea.
| Compound Name | 3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 126657870 |
| Molecular Formula | C21H38N4O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-[2-(diethylamino)ethyl]-1-methylurea |
| SMILES | C=C1C[C@@H]2[C@@H](CC1=O)C[C@H](NC(=O)N(C)CCN(CC)CC)CN2CCC |
| InChI | InChI=1S/C21H38N4O2/c1-6-9-25-15-18(13-17-14-20(26)16(4)12-19(17)25)22-21(27)23(5)10-11-24(7-2)8-3/h17-19H,4,6-15H2,1-3,5H3,(H,22,27)/t17-,18+,19-/m1/s1 |
| InChIKey | ZFMSEPKQEKQUQT-CEXWTWQISA-N |
| XLogP | 2.36 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|