C24H36N4O2 — CID 126657999
3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-methyl-1-[2-(N-methylanilino)ethyl]urea (PubChem CID 126657999) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-methyl-1-[2-(N-methylanilino)ethyl]urea.
| Compound Name | 3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-methyl-1-[2-(N-methylanilino)ethyl]urea |
|---|---|
| PubChem CID | 126657999 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 3-[(3S,4aR,8aR)-7-methylidene-6-oxo-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-3-yl]-1-methyl-1-[2-(N-methylanilino)ethyl]urea |
| SMILES | C=C1C[C@@H]2[C@@H](CC1=O)C[C@H](NC(=O)N(C)CCN(C)c1ccccc1)CN2CCC |
| InChI | InChI=1S/C24H36N4O2/c1-5-11-28-17-20(15-19-16-23(29)18(2)14-22(19)28)25-24(30)27(4)13-12-26(3)21-9-7-6-8-10-21/h6-10,19-20,22H,2,5,11-17H2,1,3-4H3,(H,25,30)/t19-,20+,22-/m1/s1 |
| InChIKey | HGSYSAIVSKMXMJ-RZUBCFFCSA-N |
| XLogP | 3.15 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|