C8H12Br2N2O3S — CID 12665801
2,4-dibromo-6-butyl-5-methyl-1,1-dioxo-1,2,6-thiadiazin-3-one (PubChem CID 12665801) has the molecular formula C8H12Br2N2O3S and a molecular weight of 376.07 g/mol. Its IUPAC name is 2,4-dibromo-6-butyl-5-methyl-1,1-dioxo-1,2,6-thiadiazin-3-one.
| Compound Name | 2,4-dibromo-6-butyl-5-methyl-1,1-dioxo-1,2,6-thiadiazin-3-one |
|---|---|
| PubChem CID | 12665801 |
| Molecular Formula | C8H12Br2N2O3S |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 373.89 |
| IUPAC Name | 2,4-dibromo-6-butyl-5-methyl-1,1-dioxo-1,2,6-thiadiazin-3-one |
| SMILES | CCCCN1C(C)=C(Br)C(=O)N(Br)S1(=O)=O |
| InChI | InChI=1S/C8H12Br2N2O3S/c1-3-4-5-11-6(2)7(9)8(13)12(10)16(11,14)15/h3-5H2,1-2H3 |
| InChIKey | QTYMHABLQORIIR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|