C16H25N — CID 126658051
3,7a-dimethyl-2,5-di(propan-2-yl)-3,7-dihydroindole (PubChem CID 126658051) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 3,7a-dimethyl-2,5-di(propan-2-yl)-3,7-dihydroindole.
| Compound Name | 3,7a-dimethyl-2,5-di(propan-2-yl)-3,7-dihydroindole |
|---|---|
| PubChem CID | 126658051 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3,7a-dimethyl-2,5-di(propan-2-yl)-3,7-dihydroindole |
| SMILES | CC(C)C1=CCC2(C)N=C(C(C)C)C(C)C2=C1 |
| InChI | InChI=1S/C16H25N/c1-10(2)13-7-8-16(6)14(9-13)12(5)15(17-16)11(3)4/h7,9-12H,8H2,1-6H3 |
| InChIKey | CLZGEFYKVBYNHO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |