C21H33N — CID 126658156
(3E,4E,6E)-3-ethylidene-7-(3-methylcyclopropen-1-yl)-N,4-dipropylnona-1,4,6-trien-2-amine (PubChem CID 126658156) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is (3E,4E,6E)-3-ethylidene-7-(3-methylcyclopropen-1-yl)-N,4-dipropylnona-1,4,6-trien-2-amine.
| Compound Name | (3E,4E,6E)-3-ethylidene-7-(3-methylcyclopropen-1-yl)-N,4-dipropylnona-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 126658156 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (3E,4E,6E)-3-ethylidene-7-(3-methylcyclopropen-1-yl)-N,4-dipropylnona-1,4,6-trien-2-amine |
| SMILES | C=C(NCCC)C(=C/C)/C(=C/C=C(\CC)C1=CC1C)CCC |
| InChI | InChI=1S/C21H33N/c1-7-11-19(20(10-4)17(6)22-14-8-2)13-12-18(9-3)21-15-16(21)5/h10,12-13,15-16,22H,6-9,11,14H2,1-5H3/b18-12+,19-13+,20-10- |
| InChIKey | MKUAFWMXRVGVIC-BHAPQERLSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|