About 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene
5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene (PubChem CID 126658211) has the molecular formula C15H28S
and a molecular weight of 240.46 g/mol. Its IUPAC name is 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene |
| PubChem CID | 126658211 |
| Molecular Formula | C15H28S |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene |
| SMILES | CCC1CSC(C(C)(C)C)=C1C(C)(C)CC |
| InChI | InChI=1S/C15H28S/c1-8-11-10-16-13(14(3,4)5)12(11)15(6,7)9-2/h11H,8-10H2,1-7H3 |
| InChIKey | RWXHQSZUORZTQN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene?
The IUPAC name of 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene (CID 126658211) is 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene.
What is the SMILES notation for 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene?
The canonical SMILES for 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene is CCC1CSC(C(C)(C)C)=C1C(C)(C)CC.
What is the InChIKey of 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene?
The InChIKey is RWXHQSZUORZTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28S/c1-8-11-10-16-13(14(3,4)5)12(11)15(6,7)9-2/h11H,8-10H2,1-7H3.
What are the key properties of 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene?
5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene has a molecular weight of 240.46 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-ethyl-4-(2-methylbutan-2-yl)-2,3-dihydrothiophene is sourced from PubChem (CID 126658211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).