C19H32N6O5S — CID 126658553
(2S)-5-(diaminomethylideneamino)-2-[[2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid (PubChem CID 126658553) has the molecular formula C19H32N6O5S and a molecular weight of 456.57 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 126658553 |
| Molecular Formula | C19H32N6O5S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)cs1 |
| InChI | InChI=1S/C19H32N6O5S/c1-10(2)13(25-18(29)30-19(3,4)5)15-24-12(9-31-15)14(26)23-11(16(27)28)7-6-8-22-17(20)21/h9-11,13H,6-8H2,1-5H3,(H,23,26)(H,25,29)(H,27,28)(H4,20,21,22)/t11-,13?/m0/s1 |
| InChIKey | IQHPEDJHMODHSG-AMGKYWFPSA-N |
| XLogP | 1.60 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|