C19H31NO2 — CID 126658664
(3S)-1-[(1S,2S)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol (PubChem CID 126658664) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (3S)-1-[(1S,2S)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[(1S,2S)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126658664 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (3S)-1-[(1S,2S)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol |
| SMILES | C=C(/C=C\C=C/C)CCO[C@H]1CCCC[C@@H]1N1CC[C@H](O)C1 |
| InChI | InChI=1S/C19H31NO2/c1-3-4-5-8-16(2)12-14-22-19-10-7-6-9-18(19)20-13-11-17(21)15-20/h3-5,8,17-19,21H,2,6-7,9-15H2,1H3/b4-3-,8-5-/t17-,18-,19-/m0/s1 |
| InChIKey | LFSFMKBAJUBZCL-FTXGCNOMSA-N |
| XLogP | 3.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|