C15H25NO — CID 126658665
trans-(1R,2R)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexan-1-amine (PubChem CID 126658665) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 126658665 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | trans-(1R,2R)-2-[(4Z,6Z)-3-methylideneocta-4,6-dienoxy]cyclohexan-1-amine |
| SMILES | C=C(/C=C\C=C/C)CCO[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C15H25NO/c1-3-4-5-8-13(2)11-12-17-15-10-7-6-9-14(15)16/h3-5,8,14-15H,2,6-7,9-12,16H2,1H3/b4-3-,8-5-/t14-,15-/m1/s1 |
| InChIKey | LGSBCCCLOGPHPS-HSENIMIHSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|