C16H27NO — CID 126658667
trans-(1R,2R)-2-[(3E,5Z,7Z)-3-methylnona-3,5,7-trienoxy]cyclohexan-1-amine (PubChem CID 126658667) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(3E,5Z,7Z)-3-methylnona-3,5,7-trienoxy]cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-[(3E,5Z,7Z)-3-methylnona-3,5,7-trienoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 126658667 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | trans-(1R,2R)-2-[(3E,5Z,7Z)-3-methylnona-3,5,7-trienoxy]cyclohexan-1-amine |
| SMILES | C/C=C\C=C/C=C(\C)CCO[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C16H27NO/c1-3-4-5-6-9-14(2)12-13-18-16-11-8-7-10-15(16)17/h3-6,9,15-16H,7-8,10-13,17H2,1-2H3/b4-3-,6-5-,14-9+/t15-,16-/m1/s1 |
| InChIKey | CZUWWXYPBHIJLE-FUBFOEBASA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|