About N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine
N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine (PubChem CID 126658712) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine |
| PubChem CID | 126658712 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine |
| SMILES | CC(C)CCCN(C)CC1=CC=CC1 |
| InChI | InChI=1S/C13H23N/c1-12(2)7-6-10-14(3)11-13-8-4-5-9-13/h4-5,8,12H,6-7,9-11H2,1-3H3 |
| InChIKey | SIPZWQOXSBIZMB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine?
The IUPAC name of N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine (CID 126658712) is N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine.
What is the SMILES notation for N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine?
The canonical SMILES for N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine is CC(C)CCCN(C)CC1=CC=CC1.
What is the InChIKey of N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine?
The InChIKey is SIPZWQOXSBIZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-12(2)7-6-10-14(3)11-13-8-4-5-9-13/h4-5,8,12H,6-7,9-11H2,1-3H3.
What are the key properties of N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine?
N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine has a molecular weight of 193.33 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopenta-1,3-dien-1-ylmethyl)-N,4-dimethylpentan-1-amine is sourced from PubChem (CID 126658712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).