C20H33NO2 — CID 126658762
(3S)-1-[(1S,2R)-2-[(3Z,4Z,6Z)-3-ethylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol (PubChem CID 126658762) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (3S)-1-[(1S,2R)-2-[(3Z,4Z,6Z)-3-ethylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[(1S,2R)-2-[(3Z,4Z,6Z)-3-ethylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 126658762 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (3S)-1-[(1S,2R)-2-[(3Z,4Z,6Z)-3-ethylideneocta-4,6-dienoxy]cyclohexyl]pyrrolidin-3-ol |
| SMILES | C/C=C\C=C/C(=C\C)CCO[C@@H]1CCCC[C@@H]1N1CC[C@H](O)C1 |
| InChI | InChI=1S/C20H33NO2/c1-3-5-6-9-17(4-2)13-15-23-20-11-8-7-10-19(20)21-14-12-18(22)16-21/h3-6,9,18-20,22H,7-8,10-16H2,1-2H3/b5-3-,9-6-,17-4+/t18-,19-,20+/m0/s1 |
| InChIKey | YRKGCTAGBMFYFM-RLAQWZHCSA-N |
| XLogP | 3.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|