C7H6N4 — CID 126658836
9-methyl-1,4,8,10-tetrazabicyclo[5.3.0]deca-2,4,5,7,9-pentaene (PubChem CID 126658836) has the molecular formula C7H6N4 and a molecular weight of 146.15 g/mol. Its IUPAC name is 9-methyl-1,4,8,10-tetrazabicyclo[5.3.0]deca-2,4,5,7,9-pentaene.
| Compound Name | 9-methyl-1,4,8,10-tetrazabicyclo[5.3.0]deca-2,4,5,7,9-pentaene |
|---|---|
| PubChem CID | 126658836 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 9-methyl-1,4,8,10-tetrazabicyclo[5.3.0]deca-2,4,5,7,9-pentaene |
| SMILES | Cc1nc2n(n1)C=CN=C=C2 |
| InChI | InChI=1S/C7H6N4/c1-6-9-7-2-3-8-4-5-11(7)10-6/h2,4-5H,1H3 |
| InChIKey | PHNIXKGAZHGEAO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |