About 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide
4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide (PubChem CID 126659054) has the molecular formula C21H23N5O
and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide.
Molecular Properties
| Compound Name | 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide |
| PubChem CID | 126659054 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide |
| SMILES | CN1CCC(c2ccccc2)[C@@H](Nc2ncnc3c(C(N)=O)cccc23)C1 |
| InChI | InChI=1S/C21H23N5O/c1-26-11-10-15(14-6-3-2-4-7-14)18(12-26)25-21-17-9-5-8-16(20(22)27)19(17)23-13-24-21/h2-9,13,15,18H,10-12H2,1H3,(H2,22,27)(H,23,24,25)/t15?,18-/m0/s1 |
| InChIKey | LDRRHCWCSOPJHM-PKHIMPSTSA-N |
| XLogP | 2.63 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide?
The IUPAC name of 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide (CID 126659054) is 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide.
What is the SMILES notation for 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide?
The canonical SMILES for 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide is CN1CCC(c2ccccc2)[C@@H](Nc2ncnc3c(C(N)=O)cccc23)C1.
What is the InChIKey of 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide?
The InChIKey is LDRRHCWCSOPJHM-PKHIMPSTSA-N. The full InChI is InChI=1S/C21H23N5O/c1-26-11-10-15(14-6-3-2-4-7-14)18(12-26)25-21-17-9-5-8-16(20(22)27)19(17)23-13-24-21/h2-9,13,15,18H,10-12H2,1H3,(H2,22,27)(H,23,24,25)/t15?,18-/m0/s1.
What are the key properties of 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide?
4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide has a molecular weight of 361.45 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl]amino]quinazoline-8-carboxamide is sourced from PubChem (CID 126659054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).