About 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole
2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole (PubChem CID 126659130) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole.
Molecular Properties
| Compound Name | 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole |
| PubChem CID | 126659130 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole |
| SMILES | CCCc1nc2c(o1)C=CCCC2 |
| InChI | InChI=1S/C11H15NO/c1-2-6-11-12-9-7-4-3-5-8-10(9)13-11/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | RSJKRFHGECAPPR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole?
The IUPAC name of 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole (CID 126659130) is 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole.
What is the SMILES notation for 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole?
The canonical SMILES for 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole is CCCc1nc2c(o1)C=CCCC2.
What is the InChIKey of 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole?
The InChIKey is RSJKRFHGECAPPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-6-11-12-9-7-4-3-5-8-10(9)13-11/h5,8H,2-4,6-7H2,1H3.
What are the key properties of 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole?
2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole has a molecular weight of 177.25 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5,6-dihydro-4H-cyclohepta[d][1,3]oxazole is sourced from PubChem (CID 126659130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).