C30H43F3N2 — CID 126659142
(Z,4E)-4-[(E)-dec-3-enylidene]-N-[(2E)-2-ethenylpenta-2,4-dienyl]-N'-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trienyl]pent-2-ene-1,5-diamine (PubChem CID 126659142) has the molecular formula C30H43F3N2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (Z,4E)-4-[(E)-dec-3-enylidene]-N-[(2E)-2-ethenylpenta-2,4-dienyl]-N'-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trienyl]pent-2-ene-1,5-diamine.
| Compound Name | (Z,4E)-4-[(E)-dec-3-enylidene]-N-[(2E)-2-ethenylpenta-2,4-dienyl]-N'-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trienyl]pent-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 126659142 |
| Molecular Formula | C30H43F3N2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (Z,4E)-4-[(E)-dec-3-enylidene]-N-[(2E)-2-ethenylpenta-2,4-dienyl]-N'-[(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-trienyl]pent-2-ene-1,5-diamine |
| SMILES | C=C/C=C(\C=C)CNC/C=C\C(=C/C/C=C/CCCCCC)CNC/C=C/C=C(\C=C)C(F)(F)F |
| InChI | InChI=1S/C30H43F3N2/c1-5-9-10-11-12-13-14-15-20-28(21-18-24-35-25-27(7-3)19-6-2)26-34-23-17-16-22-29(8-4)30(31,32)33/h6-8,13-14,16-22,34-35H,2-5,9-12,15,23-26H2,1H3/b14-13+,17-16+,21-18-,27-19+,28-20+,29-22+ |
| InChIKey | BTLNDGIGXJAJAM-WAAXJRCYSA-N |
| XLogP | 8.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|