C28H31ClN4O3 — CID 126659155
amino 4-[2-[8-[(4-chlorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 126659155) has the molecular formula C28H31ClN4O3 and a molecular weight of 507.03 g/mol. Its IUPAC name is amino 4-[2-[8-[(4-chlorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | amino 4-[2-[8-[(4-chlorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 126659155 |
| Molecular Formula | C28H31ClN4O3 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | amino 4-[2-[8-[(4-chlorophenyl)methyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl]-2-oxoethyl]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | NOC(=O)C12CCC(CC(=O)N3CCc4c(n(Cc5ccc(Cl)cc5)c5ncccc45)C3)(CC1)CC2 |
| InChI | InChI=1S/C28H31ClN4O3/c29-20-5-3-19(4-6-20)17-33-23-18-32(15-7-21(23)22-2-1-14-31-25(22)33)24(34)16-27-8-11-28(12-9-27,13-10-27)26(35)36-30/h1-6,14H,7-13,15-18,30H2 |
| InChIKey | FBPLUQQORDCFLG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|