C10H9F — CID 126659190
6-fluoro-4,5-didehydro-1,2,3,6-tetrahydroazulene (PubChem CID 126659190) has the molecular formula C10H9F and a molecular weight of 148.18 g/mol. Its IUPAC name is 6-fluoro-4,5-didehydro-1,2,3,6-tetrahydroazulene.
| Compound Name | 6-fluoro-4,5-didehydro-1,2,3,6-tetrahydroazulene |
|---|---|
| PubChem CID | 126659190 |
| Molecular Formula | C10H9F |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 6-fluoro-4,5-didehydro-1,2,3,6-tetrahydroazulene |
| SMILES | FC1C#CC2=C(C=C1)CCC2 |
| InChI | InChI=1S/C10H9F/c11-10-6-4-8-2-1-3-9(8)5-7-10/h4,6,10H,1-3H2 |
| InChIKey | BCXLMPKAWOHIJY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|