C21H22O5 — CID 126659206
2-[(3E,5E)-6-hydroxyhexa-1,3,5-trien-3-yl]-5-methoxy-8,8-dimethyl-2,3-dihydropyrano[2,3-h]chromen-4-one (PubChem CID 126659206) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-[(3E,5E)-6-hydroxyhexa-1,3,5-trien-3-yl]-5-methoxy-8,8-dimethyl-2,3-dihydropyrano[2,3-h]chromen-4-one.
| Compound Name | 2-[(3E,5E)-6-hydroxyhexa-1,3,5-trien-3-yl]-5-methoxy-8,8-dimethyl-2,3-dihydropyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 126659206 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-[(3E,5E)-6-hydroxyhexa-1,3,5-trien-3-yl]-5-methoxy-8,8-dimethyl-2,3-dihydropyrano[2,3-h]chromen-4-one |
| SMILES | C=C/C(=C\C=C\O)C1CC(=O)c2c(OC)cc3c(c2O1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C21H22O5/c1-5-13(7-6-10-22)16-11-15(23)19-18(24-4)12-17-14(20(19)25-16)8-9-21(2,3)26-17/h5-10,12,16,22H,1,11H2,2-4H3/b10-6+,13-7+ |
| InChIKey | MWGXZSLWZWIYHY-OIGXVCCLSA-N |
| XLogP | 4.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|