About N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine
N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine (PubChem CID 126659234) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine.
Molecular Properties
| Compound Name | N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine |
| PubChem CID | 126659234 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine |
| SMILES | C=C(C)CC(SC)C(=C)NC |
| InChI | InChI=1S/C9H17NS/c1-7(2)6-9(11-5)8(3)10-4/h9-10H,1,3,6H2,2,4-5H3 |
| InChIKey | AXICASRFANDJDO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine?
The IUPAC name of N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine (CID 126659234) is N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine.
What is the SMILES notation for N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine?
The canonical SMILES for N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine is C=C(C)CC(SC)C(=C)NC.
What is the InChIKey of N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine?
The InChIKey is AXICASRFANDJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-7(2)6-9(11-5)8(3)10-4/h9-10H,1,3,6H2,2,4-5H3.
What are the key properties of N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine?
N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine has a molecular weight of 171.31 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-3-methylsulfanylhexa-1,5-dien-2-amine is sourced from PubChem (CID 126659234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).