About acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate
acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 126659778) has the molecular formula C12H8O6
and a molecular weight of 248.19 g/mol. Its IUPAC name is acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate.
Molecular Properties
| Compound Name | acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate |
| PubChem CID | 126659778 |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | CC(=O)OC(=O)c1cc2c(cc1C)C(=O)OC2=O |
| InChI | InChI=1S/C12H8O6/c1-5-3-8-9(12(16)18-11(8)15)4-7(5)10(14)17-6(2)13/h3-4H,1-2H3 |
| InChIKey | DGUVNZHYSBWKNU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate?
The IUPAC name of acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate (CID 126659778) is acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate.
What is the SMILES notation for acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate?
The canonical SMILES for acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate is CC(=O)OC(=O)c1cc2c(cc1C)C(=O)OC2=O.
What is the InChIKey of acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate?
The InChIKey is DGUVNZHYSBWKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O6/c1-5-3-8-9(12(16)18-11(8)15)4-7(5)10(14)17-6(2)13/h3-4H,1-2H3.
What are the key properties of acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate?
acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate has a molecular weight of 248.19 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 6-methyl-1,3-dioxo-2-benzofuran-5-carboxylate is sourced from PubChem (CID 126659778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).