C23H31N3O3 — CID 126659927
7-[(3-ethoxy-4-hydroxyphenyl)-(piperidin-3-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-8-ol (PubChem CID 126659927) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 7-[(3-ethoxy-4-hydroxyphenyl)-(piperidin-3-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-8-ol.
| Compound Name | 7-[(3-ethoxy-4-hydroxyphenyl)-(piperidin-3-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 126659927 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 7-[(3-ethoxy-4-hydroxyphenyl)-(piperidin-3-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-8-ol |
| SMILES | CCOc1cc(C(NC2CCCNC2)c2ccc3c(c2O)NCCC3)ccc1O |
| InChI | InChI=1S/C23H31N3O3/c1-2-29-20-13-16(8-10-19(20)27)21(26-17-6-4-11-24-14-17)18-9-7-15-5-3-12-25-22(15)23(18)28/h7-10,13,17,21,24-28H,2-6,11-12,14H2,1H3 |
| InChIKey | VEVBTIDKIZTBBI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|