C12H14F5N — CID 126659956
4,4-difluoro-N-[(1E,3Z)-hexa-1,3,5-trienyl]-3-(trifluoromethyl)pent-1-en-2-amine (PubChem CID 126659956) has the molecular formula C12H14F5N and a molecular weight of 267.24 g/mol. Its IUPAC name is 4,4-difluoro-N-[(1E,3Z)-hexa-1,3,5-trienyl]-3-(trifluoromethyl)pent-1-en-2-amine.
| Compound Name | 4,4-difluoro-N-[(1E,3Z)-hexa-1,3,5-trienyl]-3-(trifluoromethyl)pent-1-en-2-amine |
|---|---|
| PubChem CID | 126659956 |
| Molecular Formula | C12H14F5N |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4,4-difluoro-N-[(1E,3Z)-hexa-1,3,5-trienyl]-3-(trifluoromethyl)pent-1-en-2-amine |
| SMILES | C=C/C=C\C=C\NC(=C)C(C(C)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F5N/c1-4-5-6-7-8-18-9(2)10(11(3,13)14)12(15,16)17/h4-8,10,18H,1-2H2,3H3/b6-5-,8-7+ |
| InChIKey | FWNLJCJYWRULCW-IGTJQSIKSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|