C28H47N3S — CID 126659973
N-[2-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]ethyl]-N-[4-[4-[(2E)-2-(propyliminomethyl)penta-2,4-dienylidene]cyclohexyl]butyl]thiohydroxylamine (PubChem CID 126659973) has the molecular formula C28H47N3S and a molecular weight of 457.77 g/mol. Its IUPAC name is N-[2-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]ethyl]-N-[4-[4-[(2E)-2-(propyliminomethyl)penta-2,4-dienylidene]cyclohexyl]butyl]thiohydroxylamine.
| Compound Name | N-[2-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]ethyl]-N-[4-[4-[(2E)-2-(propyliminomethyl)penta-2,4-dienylidene]cyclohexyl]butyl]thiohydroxylamine |
|---|---|
| PubChem CID | 126659973 |
| Molecular Formula | C28H47N3S |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 457.35 |
| IUPAC Name | N-[2-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]ethyl]-N-[4-[4-[(2E)-2-(propyliminomethyl)penta-2,4-dienylidene]cyclohexyl]butyl]thiohydroxylamine |
| SMILES | C=C/C=C(C=C1CCC(CCCCN(S)CCNC(/C=C\C)=C/CC)CC1)/C=N/CCC |
| InChI | InChI=1S/C28H47N3S/c1-5-11-27(24-29-19-8-4)23-26-17-15-25(16-18-26)14-9-10-21-31(32)22-20-30-28(12-6-2)13-7-3/h5-6,11-13,23-25,30,32H,1,7-10,14-22H2,2-4H3/b12-6-,26-23-,27-11+,28-13+,29-24+ |
| InChIKey | ZYHMEJJWTKVKSA-BBCMHLTLSA-N |
| XLogP | 7.47 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|