About 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide
3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide (PubChem CID 126659987) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide.
Molecular Properties
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide |
| PubChem CID | 126659987 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide |
| SMILES | [H]/N=C(/CC(C)C1C=CC=CC1)N(CC)CC |
| InChI | InChI=1S/C14H24N2/c1-4-16(5-2)14(15)11-12(3)13-9-7-6-8-10-13/h6-9,12-13,15H,4-5,10-11H2,1-3H3/b15-14- |
| InChIKey | XDSYTPWSRFEWDZ-PFONDFGASA-N |
| XLogP | 3.46 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide?
The IUPAC name of 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide (CID 126659987) is 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide.
What is the SMILES notation for 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide?
The canonical SMILES for 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide is [H]/N=C(/CC(C)C1C=CC=CC1)N(CC)CC.
What is the InChIKey of 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide?
The InChIKey is XDSYTPWSRFEWDZ-PFONDFGASA-N. The full InChI is InChI=1S/C14H24N2/c1-4-16(5-2)14(15)11-12(3)13-9-7-6-8-10-13/h6-9,12-13,15H,4-5,10-11H2,1-3H3/b15-14-.
What are the key properties of 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide?
3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide has a molecular weight of 220.36 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-2,4-dien-1-yl-N,N-diethylbutanimidamide is sourced from PubChem (CID 126659987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).