About 5-fluorocyclohepta-1,4,6-trien-1-amine
5-fluorocyclohepta-1,4,6-trien-1-amine (PubChem CID 126660354) has the molecular formula C7H8FN
and a molecular weight of 125.15 g/mol. Its IUPAC name is 5-fluorocyclohepta-1,4,6-trien-1-amine.
Molecular Properties
| Compound Name | 5-fluorocyclohepta-1,4,6-trien-1-amine |
| PubChem CID | 126660354 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 5-fluorocyclohepta-1,4,6-trien-1-amine |
| SMILES | NC1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C7H8FN/c8-6-2-1-3-7(9)5-4-6/h2-5H,1,9H2 |
| InChIKey | QPQVVDRMCAYNMJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluorocyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorocyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 5-fluorocyclohepta-1,4,6-trien-1-amine (CID 126660354) is 5-fluorocyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 5-fluorocyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 5-fluorocyclohepta-1,4,6-trien-1-amine is NC1=CCC=C(F)C=C1.
What is the InChIKey of 5-fluorocyclohepta-1,4,6-trien-1-amine?
The InChIKey is QPQVVDRMCAYNMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN/c8-6-2-1-3-7(9)5-4-6/h2-5H,1,9H2.
What are the key properties of 5-fluorocyclohepta-1,4,6-trien-1-amine?
5-fluorocyclohepta-1,4,6-trien-1-amine has a molecular weight of 125.15 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorocyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 126660354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).