About 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine
1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine (PubChem CID 126660355) has the molecular formula C12H22ClF6NO5S3
and a molecular weight of 505.95 g/mol. Its IUPAC name is 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine.
Molecular Properties
| Compound Name | 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine |
| PubChem CID | 126660355 |
| Molecular Formula | C12H22ClF6NO5S3 |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine |
| SMILES | CCS(Cl)(CC)CCOCC(N)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H22ClF6NO5S3/c1-3-26(13,4-2)6-5-25-8-9(20)7-10(27(21,22)11(14,15)16)28(23,24)12(17,18)19/h9-10H,3-8,20H2,1-2H3 |
| InChIKey | XRLKKLBOGLIOND-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
The IUPAC name of 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine (CID 126660355) is 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine.
What is the SMILES notation for 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
The canonical SMILES for 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine is CCS(Cl)(CC)CCOCC(N)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
The InChIKey is XRLKKLBOGLIOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClF6NO5S3/c1-3-26(13,4-2)6-5-25-8-9(20)7-10(27(21,22)11(14,15)16)28(23,24)12(17,18)19/h9-10H,3-8,20H2,1-2H3.
What are the key properties of 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine has a molecular weight of 505.95 g/mol, XLogP of 2.91, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[chloro(diethyl)-λ4-sulfanyl]ethoxy]-4,4-bis(trifluoromethylsulfonyl)butan-2-amine is sourced from PubChem (CID 126660355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).