C27H25F3N2 — CID 12666055
(4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-2-[(E)-4-(4-fluorophenyl)but-3-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 12666055) has the molecular formula C27H25F3N2 and a molecular weight of 434.51 g/mol. Its IUPAC name is (4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-2-[(E)-4-(4-fluorophenyl)but-3-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-2-[(E)-4-(4-fluorophenyl)but-3-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 12666055 |
| Molecular Formula | C27H25F3N2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (4aR,9bR)-8-fluoro-5-(4-fluorophenyl)-2-[(E)-4-(4-fluorophenyl)but-3-enyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Fc1ccc(/C=C/CCN2CC[C@@H]3[C@@H](C2)c2cc(F)ccc2N3c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H25F3N2/c28-20-6-4-19(5-7-20)3-1-2-15-31-16-14-27-25(18-31)24-17-22(30)10-13-26(24)32(27)23-11-8-21(29)9-12-23/h1,3-13,17,25,27H,2,14-16,18H2/b3-1+/t25-,27+/m0/s1 |
| InChIKey | XHWVVKJJQIEKLC-ULBOXCRCSA-N |
| XLogP | 6.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |