C26H22N2O6 — CID 126660596
(1R,3S,4S,11S)-4-amino-11,14-dihydroxy-8-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione (PubChem CID 126660596) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is (1R,3S,4S,11S)-4-amino-11,14-dihydroxy-8-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione.
| Compound Name | (1R,3S,4S,11S)-4-amino-11,14-dihydroxy-8-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione |
|---|---|
| PubChem CID | 126660596 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (1R,3S,4S,11S)-4-amino-11,14-dihydroxy-8-phenylmethoxy-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione |
| SMILES | N[C@@H]1c2onc(OCc3ccccc3)c2C(=O)[C@@]2(O)C(=O)C3=C(O)c4ccccc4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H22N2O6/c27-20-17-11-15-10-14-8-4-5-9-16(14)21(29)18(15)23(30)26(17,32)24(31)19-22(20)34-28-25(19)33-12-13-6-2-1-3-7-13/h1-9,15,17,20,29,32H,10-12,27H2/t15-,17-,20-,26-/m0/s1 |
| InChIKey | LOOSKBULUNBADA-BYZXSBJISA-N |
| XLogP | 2.91 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|