C22H27N5O4S — CID 126660715
4-[[7-(3-acetamidophenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methyl]-N-hydroxy-N-methylpiperazin-1-amine oxide (PubChem CID 126660715) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is 4-[[7-(3-acetamidophenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methyl]-N-hydroxy-N-methylpiperazin-1-amine oxide.
| Compound Name | 4-[[7-(3-acetamidophenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methyl]-N-hydroxy-N-methylpiperazin-1-amine oxide |
|---|---|
| PubChem CID | 126660715 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[[7-(3-acetamidophenyl)-5-methyl-4-oxothieno[3,2-c]pyridin-2-yl]methyl]-N-hydroxy-N-methylpiperazin-1-amine oxide |
| SMILES | CC(=O)Nc1cccc(-c2cn(C)c(=O)c3cc(CN4CCN([N+](C)([O-])O)CC4)sc23)c1 |
| InChI | InChI=1S/C22H27N5O4S/c1-15(28)23-17-6-4-5-16(11-17)20-14-24(2)22(29)19-12-18(32-21(19)20)13-25-7-9-26(10-8-25)27(3,30)31/h4-6,11-12,14,30H,7-10,13H2,1-3H3,(H,23,28) |
| InChIKey | HNHHQJMHRKOBKX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|