C23H38N2 — CID 126660744
2,4-dimethyl-N-[(2Z,4Z)-3-(prop-1-en-2-yliminomethyl)hepta-2,4-dien-4-yl]dec-1-en-3-imine (PubChem CID 126660744) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(2Z,4Z)-3-(prop-1-en-2-yliminomethyl)hepta-2,4-dien-4-yl]dec-1-en-3-imine.
| Compound Name | 2,4-dimethyl-N-[(2Z,4Z)-3-(prop-1-en-2-yliminomethyl)hepta-2,4-dien-4-yl]dec-1-en-3-imine |
|---|---|
| PubChem CID | 126660744 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | 2,4-dimethyl-N-[(2Z,4Z)-3-(prop-1-en-2-yliminomethyl)hepta-2,4-dien-4-yl]dec-1-en-3-imine |
| SMILES | C=C(C)/N=C/C(=C\C)C(=C/CC)/N=C(\C(=C)C)C(C)CCCCCC |
| InChI | InChI=1S/C23H38N2/c1-9-12-13-14-16-20(8)23(18(4)5)25-22(15-10-2)21(11-3)17-24-19(6)7/h11,15,17,20H,4,6,9-10,12-14,16H2,1-3,5,7-8H3/b21-11+,22-15-,24-17+,25-23+ |
| InChIKey | CVVNFXCITQSUEV-JWKFESQTSA-N |
| XLogP | 7.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|