About 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile
2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile (PubChem CID 126660873) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile |
| PubChem CID | 126660873 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile |
| SMILES | N#CCC1=CC(C(F)(F)F)CC=C1N |
| InChI | InChI=1S/C9H9F3N2/c10-9(11,12)7-1-2-8(14)6(5-7)3-4-13/h2,5,7H,1,3,14H2 |
| InChIKey | UTFUUHCBPFJVFO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile?
The IUPAC name of 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile (CID 126660873) is 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile.
What is the SMILES notation for 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile?
The canonical SMILES for 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile is N#CCC1=CC(C(F)(F)F)CC=C1N.
What is the InChIKey of 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile?
The InChIKey is UTFUUHCBPFJVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2/c10-9(11,12)7-1-2-8(14)6(5-7)3-4-13/h2,5,7H,1,3,14H2.
What are the key properties of 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile?
2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile has a molecular weight of 202.18 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]acetonitrile is sourced from PubChem (CID 126660873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).