C24H40NO2PS — CID 126660964
[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-[2-(phosphanylmethylsulfanyl)ethyl]carbamate (PubChem CID 126660964) has the molecular formula C24H40NO2PS and a molecular weight of 437.63 g/mol. Its IUPAC name is [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-[2-(phosphanylmethylsulfanyl)ethyl]carbamate.
| Compound Name | [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-[2-(phosphanylmethylsulfanyl)ethyl]carbamate |
|---|---|
| PubChem CID | 126660964 |
| Molecular Formula | C24H40NO2PS |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-[2-(phosphanylmethylsulfanyl)ethyl]carbamate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(=O)NCCSCP |
| InChI | InChI=1S/C24H40NO2PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-27-24(26)25-20-22-29-23-28/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-23,28H2,1H3,(H,25,26)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | AIQNXJHRWDEPIE-JLNKQSITSA-N |
| XLogP | 7.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|