C15H24N6O2 — CID 12666101
2-[2-hydroxyethyl-[3-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propyl]amino]ethanol (PubChem CID 12666101) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[3-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[3-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propyl]amino]ethanol |
|---|---|
| PubChem CID | 12666101 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[2-hydroxyethyl-[3-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propyl]amino]ethanol |
| SMILES | Cc1nc2ncnn2c2c1CCN2CCCN(CCO)CCO |
| InChI | InChI=1S/C15H24N6O2/c1-12-13-3-6-20(5-2-4-19(7-9-22)8-10-23)14(13)21-15(18-12)16-11-17-21/h11,22-23H,2-10H2,1H3 |
| InChIKey | QIWBIJQNZSSVMN-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |