C12H17N5O — CID 12666107
2-methyl-2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propan-1-ol (PubChem CID 12666107) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-methyl-2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propan-1-ol.
| Compound Name | 2-methyl-2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 12666107 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-methyl-2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)propan-1-ol |
| SMILES | Cc1nc2ncnn2c2c1CCN2C(C)(C)CO |
| InChI | InChI=1S/C12H17N5O/c1-8-9-4-5-16(12(2,3)6-18)10(9)17-11(15-8)13-7-14-17/h7,18H,4-6H2,1-3H3 |
| InChIKey | QOSNQSCWGBQGFB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |