About (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one
(3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one (PubChem CID 126661146) has the molecular formula C20H18F3NO
and a molecular weight of 345.36 g/mol. Its IUPAC name is (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one.
Molecular Properties
| Compound Name | (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one |
| PubChem CID | 126661146 |
| Molecular Formula | C20H18F3NO |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one |
| SMILES | C/C(=C1/CCCNC1=O)c1cc(F)cc(-c2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C20H18F3NO/c1-11(15-4-3-7-24-20(15)25)17-8-14(22)9-18(12(17)2)16-6-5-13(21)10-19(16)23/h5-6,8-10H,3-4,7H2,1-2H3,(H,24,25)/b15-11+ |
| InChIKey | UPIMLMWXSYQCJZ-RVDMUPIBSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one?
The IUPAC name of (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one (CID 126661146) is (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one.
What is the SMILES notation for (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one?
The canonical SMILES for (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one is C/C(=C1/CCCNC1=O)c1cc(F)cc(-c2ccc(F)cc2F)c1C.
What is the InChIKey of (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one?
The InChIKey is UPIMLMWXSYQCJZ-RVDMUPIBSA-N. The full InChI is InChI=1S/C20H18F3NO/c1-11(15-4-3-7-24-20(15)25)17-8-14(22)9-18(12(17)2)16-6-5-13(21)10-19(16)23/h5-6,8-10H,3-4,7H2,1-2H3,(H,24,25)/b15-11+.
What are the key properties of (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one?
(3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one has a molecular weight of 345.36 g/mol, XLogP of 4.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[1-[3-(2,4-difluorophenyl)-5-fluoro-2-methylphenyl]ethylidene]piperidin-2-one is sourced from PubChem (CID 126661146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).