C14H21N — CID 126661351
(3E,5Z)-3-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine (PubChem CID 126661351) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine.
| Compound Name | (3E,5Z)-3-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 126661351 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (3E,5Z)-3-methyl-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-imine |
| SMILES | C=C(C)C(=C/C)/N=C(C)/C(C)=C/C=C\C |
| InChI | InChI=1S/C14H21N/c1-7-9-10-12(5)13(6)15-14(8-2)11(3)4/h7-10H,3H2,1-2,4-6H3/b9-7-,12-10+,14-8-,15-13+ |
| InChIKey | HOSVXVMZKSNMCF-ARHRVUBFSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|