C24H39NS — CID 126661375
2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-1,7,10,13,16,19-hexaen-2-yl]amino]ethanethiol (PubChem CID 126661375) has the molecular formula C24H39NS and a molecular weight of 373.65 g/mol. Its IUPAC name is 2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-1,7,10,13,16,19-hexaen-2-yl]amino]ethanethiol.
| Compound Name | 2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-1,7,10,13,16,19-hexaen-2-yl]amino]ethanethiol |
|---|---|
| PubChem CID | 126661375 |
| Molecular Formula | C24H39NS |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-[[(7Z,10Z,13Z,16Z,19Z)-docosa-1,7,10,13,16,19-hexaen-2-yl]amino]ethanethiol |
| SMILES | C=C(CCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)NCCS |
| InChI | InChI=1S/C24H39NS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(2)25-22-23-26/h4-5,7-8,10-11,13-14,16-17,25-26H,2-3,6,9,12,15,18-23H2,1H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | CWIWAZBQQCNYTA-JEBPEJKESA-N |
| XLogP | 7.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|